C24H23BrN2O2S — CID 17072930
N-[benzyl(methyl)carbamothioyl]-3-bromo-4-(2-phenylethoxy)benzamide (PubChem CID 17072930) has the molecular formula C24H23BrN2O2S and a molecular weight of 483.43 g/mol. Its IUPAC name is N-[benzyl(methyl)carbamothioyl]-3-bromo-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[benzyl(methyl)carbamothioyl]-3-bromo-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17072930 |
| Molecular Formula | C24H23BrN2O2S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | N-[benzyl(methyl)carbamothioyl]-3-bromo-4-(2-phenylethoxy)benzamide |
| SMILES | CN(Cc1ccccc1)C(=S)NC(=O)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C24H23BrN2O2S/c1-27(17-19-10-6-3-7-11-19)24(30)26-23(28)20-12-13-22(21(25)16-20)29-15-14-18-8-4-2-5-9-18/h2-13,16H,14-15,17H2,1H3,(H,26,28,30) |
| InChIKey | IEQQJIBNBXDEBL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|