C22H24BrN3O3S — CID 54790489
3-bromo-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 54790489) has the molecular formula C22H24BrN3O3S and a molecular weight of 490.42 g/mol. Its IUPAC name is 3-bromo-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | 3-bromo-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 54790489 |
| Molecular Formula | C22H24BrN3O3S |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 3-bromo-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)N(CCC#N)CCc2ccccc2)cc1Br |
| InChI | InChI=1S/C22H24BrN3O3S/c1-28-14-15-29-20-9-8-18(16-19(20)23)21(27)25-22(30)26(12-5-11-24)13-10-17-6-3-2-4-7-17/h2-4,6-9,16H,5,10,12-15H2,1H3,(H,25,27,30) |
| InChIKey | VPACOKUTTCNGCR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|