C21H23ClFNO2S — CID 4042855
[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-piperidin-1-ylmethanethione (PubChem CID 4042855) has the molecular formula C21H23ClFNO2S and a molecular weight of 407.94 g/mol. Its IUPAC name is [3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-piperidin-1-ylmethanethione.
| Compound Name | [3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-piperidin-1-ylmethanethione |
|---|---|
| PubChem CID | 4042855 |
| Molecular Formula | C21H23ClFNO2S |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-piperidin-1-ylmethanethione |
| SMILES | CCOc1cc(C(=S)N2CCCCC2)cc(Cl)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C21H23ClFNO2S/c1-2-25-19-13-16(21(27)24-9-4-3-5-10-24)12-18(22)20(19)26-14-15-7-6-8-17(23)11-15/h6-8,11-13H,2-5,9-10,14H2,1H3 |
| InChIKey | XMQZIMGUGNEZJV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|