C21H24ClNO3 — CID 2302016
(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone (PubChem CID 2302016) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is (3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone.
| Compound Name | (3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 2302016 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone |
| SMILES | CCOc1cc(C(=O)N2CCCCC2)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H24ClNO3/c1-2-25-19-14-17(21(24)23-11-7-4-8-12-23)13-18(22)20(19)26-15-16-9-5-3-6-10-16/h3,5-6,9-10,13-14H,2,4,7-8,11-12,15H2,1H3 |
| InChIKey | GNHXEXYSCIMOBH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |