C20H21ClFNO3S — CID 1261044
[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione (PubChem CID 1261044) has the molecular formula C20H21ClFNO3S and a molecular weight of 409.91 g/mol. Its IUPAC name is [3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione.
| Compound Name | [3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 1261044 |
| Molecular Formula | C20H21ClFNO3S |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione |
| SMILES | CCOc1cc(C(=S)N2CCOCC2)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C20H21ClFNO3S/c1-2-25-18-12-15(20(27)23-7-9-24-10-8-23)11-16(21)19(18)26-13-14-5-3-4-6-17(14)22/h3-6,11-12H,2,7-10,13H2,1H3 |
| InChIKey | NXBFLIRHWAWSSB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|