C18H16Br2ClNO2S — CID 126378097
[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione (PubChem CID 126378097) has the molecular formula C18H16Br2ClNO2S and a molecular weight of 505.66 g/mol. Its IUPAC name is [3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione.
| Compound Name | [3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 126378097 |
| Molecular Formula | C18H16Br2ClNO2S |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 502.90 |
| IUPAC Name | [3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione |
| SMILES | S=C(c1cc(Br)c(OCc2ccccc2Cl)c(Br)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H16Br2ClNO2S/c19-14-9-13(18(25)22-5-7-23-8-6-22)10-15(20)17(14)24-11-12-3-1-2-4-16(12)21/h1-4,9-10H,5-8,11H2 |
| InChIKey | WQOAONJUQSILLC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|