C20H18BrCl2NO4S — CID 1368569
[2-bromo-6-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 2,4-dichlorobenzoate (PubChem CID 1368569) has the molecular formula C20H18BrCl2NO4S and a molecular weight of 519.24 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-bromo-6-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 1368569 |
| Molecular Formula | C20H18BrCl2NO4S |
| Molecular Weight | 519.24 g/mol |
| Exact Mass | 516.95 |
| IUPAC Name | [2-bromo-6-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 2,4-dichlorobenzoate |
| SMILES | CCOc1cc(C(=S)N2CCOCC2)cc(Br)c1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H18BrCl2NO4S/c1-2-27-17-10-12(19(29)24-5-7-26-8-6-24)9-15(21)18(17)28-20(25)14-4-3-13(22)11-16(14)23/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | XFMBTHGGRWWORB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|