C18H14Cl3NO3S — CID 1329344
[4-chloro-2-(morpholine-4-carbothioyl)phenyl] 2,5-dichlorobenzoate (PubChem CID 1329344) has the molecular formula C18H14Cl3NO3S and a molecular weight of 430.74 g/mol. Its IUPAC name is [4-chloro-2-(morpholine-4-carbothioyl)phenyl] 2,5-dichlorobenzoate.
| Compound Name | [4-chloro-2-(morpholine-4-carbothioyl)phenyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 1329344 |
| Molecular Formula | C18H14Cl3NO3S |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | [4-chloro-2-(morpholine-4-carbothioyl)phenyl] 2,5-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(Cl)cc1C(=S)N1CCOCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H14Cl3NO3S/c19-11-1-3-15(21)13(9-11)18(23)25-16-4-2-12(20)10-14(16)17(26)22-5-7-24-8-6-22/h1-4,9-10H,5-8H2 |
| InChIKey | CMTOHTCQWPGPEB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|