C15H13Cl2NO2S — CID 786411
[5-(2,5-dichlorophenyl)furan-2-yl]-morpholin-4-ylmethanethione (PubChem CID 786411) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is [5-(2,5-dichlorophenyl)furan-2-yl]-morpholin-4-ylmethanethione.
| Compound Name | [5-(2,5-dichlorophenyl)furan-2-yl]-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 786411 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | [5-(2,5-dichlorophenyl)furan-2-yl]-morpholin-4-ylmethanethione |
| SMILES | S=C(c1ccc(-c2cc(Cl)ccc2Cl)o1)N1CCOCC1 |
| InChI | InChI=1S/C15H13Cl2NO2S/c16-10-1-2-12(17)11(9-10)13-3-4-14(20-13)15(21)18-5-7-19-8-6-18/h1-4,9H,5-8H2 |
| InChIKey | KORAHNXRCDXTID-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_amide_A(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|