C21H18Cl2N2OS — CID 1418434
[5-(2,5-dichlorophenyl)furan-2-yl]-(4-phenylpiperazin-1-yl)methanethione (PubChem CID 1418434) has the molecular formula C21H18Cl2N2OS and a molecular weight of 417.36 g/mol. Its IUPAC name is [5-(2,5-dichlorophenyl)furan-2-yl]-(4-phenylpiperazin-1-yl)methanethione.
| Compound Name | [5-(2,5-dichlorophenyl)furan-2-yl]-(4-phenylpiperazin-1-yl)methanethione |
|---|---|
| PubChem CID | 1418434 |
| Molecular Formula | C21H18Cl2N2OS |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [5-(2,5-dichlorophenyl)furan-2-yl]-(4-phenylpiperazin-1-yl)methanethione |
| SMILES | S=C(c1ccc(-c2cc(Cl)ccc2Cl)o1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H18Cl2N2OS/c22-15-6-7-18(23)17(14-15)19-8-9-20(26-19)21(27)25-12-10-24(11-13-25)16-4-2-1-3-5-16/h1-9,14H,10-13H2 |
| InChIKey | VPIRTSBZLKBSEZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_amide_A(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|