C26H21Cl2N3O4S — CID 126027052
(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126027052) has the molecular formula C26H21Cl2N3O4S and a molecular weight of 542.44 g/mol. Its IUPAC name is (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126027052 |
| Molecular Formula | C26H21Cl2N3O4S |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3cc(Cl)ccc3Cl)o2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H21Cl2N3O4S/c27-17-6-8-21(28)20(14-17)22-9-7-19(35-22)15-23-25(33)31(26(34)36-23)16-24(32)30-12-10-29(11-13-30)18-4-2-1-3-5-18/h1-9,14-15H,10-13,16H2/b23-15+ |
| InChIKey | PQUNYUGGALYRCC-HZHRSRAPSA-N |
| XLogP | 5.64 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|