C26H21ClN4O6S — CID 126015365
(5Z)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126015365) has the molecular formula C26H21ClN4O6S and a molecular weight of 553.00 g/mol. Its IUPAC name is (5Z)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126015365 |
| Molecular Formula | C26H21ClN4O6S |
| Molecular Weight | 553.00 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | (5Z)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(-c3ccc(Cl)c([N+](=O)[O-])c3)o2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H21ClN4O6S/c27-20-8-6-17(14-21(20)31(35)36)22-9-7-19(37-22)15-23-25(33)30(26(34)38-23)16-24(32)29-12-10-28(11-13-29)18-4-2-1-3-5-18/h1-9,14-15H,10-13,16H2/b23-15- |
| InChIKey | GTWVLANXMURKKZ-HAHDFKILSA-N |
| XLogP | 4.89 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.00 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|