C21H12ClN3O7S — CID 124641720
(5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124641720) has the molecular formula C21H12ClN3O7S and a molecular weight of 485.86 g/mol. Its IUPAC name is (5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124641720 |
| Molecular Formula | C21H12ClN3O7S |
| Molecular Weight | 485.86 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | (5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3ccc(Cl)c([N+](=O)[O-])c3)o2)C(=O)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H12ClN3O7S/c22-16-7-3-13(9-17(16)25(30)31)18-8-6-15(32-18)10-19-20(26)23(21(27)33-19)11-12-1-4-14(5-2-12)24(28)29/h1-10H,11H2/b19-10+ |
| InChIKey | HROGVSFKCFGXPM-VXLYETTFSA-N |
| XLogP | 5.65 |
| TPSA | 136.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.86 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|