C22H13F3N2O5S — CID 124641777
(5E)-3-[(4-nitrophenyl)methyl]-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124641777) has the molecular formula C22H13F3N2O5S and a molecular weight of 474.42 g/mol. Its IUPAC name is (5E)-3-[(4-nitrophenyl)methyl]-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-nitrophenyl)methyl]-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124641777 |
| Molecular Formula | C22H13F3N2O5S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | (5E)-3-[(4-nitrophenyl)methyl]-5-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3ccccc3C(F)(F)F)o2)C(=O)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13F3N2O5S/c23-22(24,25)17-4-2-1-3-16(17)18-10-9-15(32-18)11-19-20(28)26(21(29)33-19)12-13-5-7-14(8-6-13)27(30)31/h1-11H,12H2/b19-11+ |
| InChIKey | IUHWOISURXXBMV-YBFXNURJSA-N |
| XLogP | 6.11 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|