C23H14N2O8S — CID 126370643
2-[5-[(Z)-[3-[2-(4-nitrophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126370643) has the molecular formula C23H14N2O8S and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-[5-[(Z)-[3-[2-(4-nitrophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(Z)-[3-[2-(4-nitrophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126370643 |
| Molecular Formula | C23H14N2O8S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 2-[5-[(Z)-[3-[2-(4-nitrophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(-c3ccccc3C(=O)O)o2)C1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H14N2O8S/c26-18(13-5-7-14(8-6-13)25(31)32)12-24-21(27)20(34-23(24)30)11-15-9-10-19(33-15)16-3-1-2-4-17(16)22(28)29/h1-11H,12H2,(H,28,29)/b20-11- |
| InChIKey | ZUPNAQHNHGHHDA-JAIQZWGSSA-N |
| XLogP | 4.47 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|