C26H22N2O6S — CID 126379045
2-[5-[(Z)-[2,4-dioxo-3-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126379045) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-[5-[(Z)-[2,4-dioxo-3-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(Z)-[2,4-dioxo-3-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126379045 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-[5-[(Z)-[2,4-dioxo-3-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | Cc1cc(C)c(NC(=O)CN2C(=O)S/C(=C\c3ccc(-c4ccccc4C(=O)O)o3)C2=O)c(C)c1 |
| InChI | InChI=1S/C26H22N2O6S/c1-14-10-15(2)23(16(3)11-14)27-22(29)13-28-24(30)21(35-26(28)33)12-17-8-9-20(34-17)18-6-4-5-7-19(18)25(31)32/h4-12H,13H2,1-3H3,(H,27,29)(H,31,32)/b21-12- |
| InChIKey | PWXMDFZNHYGREX-MTJSOVHGSA-N |
| XLogP | 5.25 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|