C23H17N3O7S — CID 126359650
(5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126359650) has the molecular formula C23H17N3O7S and a molecular weight of 479.47 g/mol. Its IUPAC name is (5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126359650 |
| Molecular Formula | C23H17N3O7S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | (5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(-c2ccc(/C=C3\SC(=O)N(Cc4ccc([N+](=O)[O-])cc4)C3=O)o2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C23H17N3O7S/c1-13-9-18(19(26(31)32)10-14(13)2)20-8-7-17(33-20)11-21-22(27)24(23(28)34-21)12-15-3-5-16(6-4-15)25(29)30/h3-11H,12H2,1-2H3/b21-11- |
| InChIKey | YXLMOBQVGRTXII-NHDPSOOVSA-N |
| XLogP | 5.62 |
| TPSA | 136.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|