C22H12ClN3O5S — CID 126172493
2-[[(5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126172493) has the molecular formula C22H12ClN3O5S and a molecular weight of 465.87 g/mol. Its IUPAC name is 2-[[(5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126172493 |
| Molecular Formula | C22H12ClN3O5S |
| Molecular Weight | 465.87 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 2-[[(5E)-5-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)S/C(=C/c2ccc(-c3ccc(Cl)c([N+](=O)[O-])c3)o2)C1=O |
| InChI | InChI=1S/C22H12ClN3O5S/c23-17-7-5-13(9-18(17)26(29)30)19-8-6-16(31-19)10-20-21(27)25(22(28)32-20)12-15-4-2-1-3-14(15)11-24/h1-10H,12H2/b20-10+ |
| InChIKey | CATKKLQQRCSAOG-KEBDBYFISA-N |
| XLogP | 5.62 |
| TPSA | 117.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.87 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|