C22H13FN2O3S — CID 3835134
4-[5-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 3835134) has the molecular formula C22H13FN2O3S and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-[5-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 3835134 |
| Molecular Formula | C22H13FN2O3S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-[5-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(C=C3SC(=O)N(Cc4ccccc4F)C3=O)o2)cc1 |
| InChI | InChI=1S/C22H13FN2O3S/c23-18-4-2-1-3-16(18)13-25-21(26)20(29-22(25)27)11-17-9-10-19(28-17)15-7-5-14(12-24)6-8-15/h1-11H,13H2 |
| InChIKey | PALUMFVISRAGBH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|