C22H15ClFNO4S — CID 126180638
(5E)-5-[[5-(5-chloro-2-methoxyphenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126180638) has the molecular formula C22H15ClFNO4S and a molecular weight of 443.88 g/mol. Its IUPAC name is (5E)-5-[[5-(5-chloro-2-methoxyphenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(5-chloro-2-methoxyphenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126180638 |
| Molecular Formula | C22H15ClFNO4S |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | (5E)-5-[[5-(5-chloro-2-methoxyphenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(Cl)cc1-c1ccc(/C=C2/SC(=O)N(Cc3ccccc3F)C2=O)o1 |
| InChI | InChI=1S/C22H15ClFNO4S/c1-28-18-8-6-14(23)10-16(18)19-9-7-15(29-19)11-20-21(26)25(22(27)30-20)12-13-4-2-3-5-17(13)24/h2-11H,12H2,1H3/b20-11+ |
| InChIKey | TUUUAKOEJILMLB-RGVLZGJSSA-N |
| XLogP | 5.98 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|