C22H20N2O3S — CID 4035511
4-[5-[[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 4035511) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-[5-[[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 4035511 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[5-[[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(C=C3SC(=O)N(CC4CCCCC4)C3=O)o2)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c23-13-15-6-8-17(9-7-15)19-11-10-18(27-19)12-20-21(25)24(22(26)28-20)14-16-4-2-1-3-5-16/h6-12,16H,1-5,14H2 |
| InChIKey | IDYICPYADAZMQD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|