C27H24N4O2S — CID 126029967
4-[5-[(Z)-[3-methyl-4-oxo-2-(4-piperidin-1-ylphenyl)imino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 126029967) has the molecular formula C27H24N4O2S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[5-[(Z)-[3-methyl-4-oxo-2-(4-piperidin-1-ylphenyl)imino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[(Z)-[3-methyl-4-oxo-2-(4-piperidin-1-ylphenyl)imino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 126029967 |
| Molecular Formula | C27H24N4O2S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-[5-[(Z)-[3-methyl-4-oxo-2-(4-piperidin-1-ylphenyl)imino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | CN1C(=O)/C(=C/c2ccc(-c3ccc(C#N)cc3)o2)S/C1=N/c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H24N4O2S/c1-30-26(32)25(17-23-13-14-24(33-23)20-7-5-19(18-28)6-8-20)34-27(30)29-21-9-11-22(12-10-21)31-15-3-2-4-16-31/h5-14,17H,2-4,15-16H2,1H3/b25-17-,29-27+ |
| InChIKey | LTXXQVJLMRLMKY-HQKGYENSSA-N |
| XLogP | 6.04 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|