C24H25NO5S — CID 126130318
ethyl 4-[5-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126130318) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126130318 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | ethyl 4-[5-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3/SC(=O)N(CC4CCCCC4)C3=O)o2)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-2-29-23(27)18-10-8-17(9-11-18)20-13-12-19(30-20)14-21-22(26)25(24(28)31-21)15-16-6-4-3-5-7-16/h8-14,16H,2-7,15H2,1H3/b21-14+ |
| InChIKey | JRZNWEUEZLJAJF-KGENOOAVSA-N |
| XLogP | 5.74 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|