C31H26N2O4S — CID 17389054
ethyl 4-[5-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 17389054) has the molecular formula C31H26N2O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 17389054 |
| Molecular Formula | C31H26N2O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | ethyl 4-[5-[(E)-(3-benzyl-2-benzylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3/S/C(=N\Cc4ccccc4)N(Cc4ccccc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C31H26N2O4S/c1-2-36-30(35)25-15-13-24(14-16-25)27-18-17-26(37-27)19-28-29(34)33(21-23-11-7-4-8-12-23)31(38-28)32-20-22-9-5-3-6-10-22/h3-19H,2,20-21H2,1H3/b28-19+,32-31- |
| InChIKey | DMCGLHNECVTLKR-GXQADQIFSA-N |
| XLogP | 6.80 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|