C25H26N2O6S — CID 4543226
ethyl 4-[5-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 4543226) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is ethyl 4-[5-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4543226 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | ethyl 4-[5-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C3SC(=O)N(CC(=O)N4CCCCCC4)C3=O)o2)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-2-32-24(30)18-9-7-17(8-10-18)20-12-11-19(33-20)15-21-23(29)27(25(31)34-21)16-22(28)26-13-5-3-4-6-14-26/h7-12,15H,2-6,13-14,16H2,1H3 |
| InChIKey | XASPKMJYMBYJDG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|