C17H13NO5S — CID 6283210
ethyl 4-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 6283210) has the molecular formula C17H13NO5S and a molecular weight of 343.36 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6283210 |
| Molecular Formula | C17H13NO5S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | ethyl 4-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3\SC(=O)NC3=O)o2)cc1 |
| InChI | InChI=1S/C17H13NO5S/c1-2-22-16(20)11-5-3-10(4-6-11)13-8-7-12(23-13)9-14-15(19)18-17(21)24-14/h3-9H,2H2,1H3,(H,18,19,21)/b14-9- |
| InChIKey | LCRNVKJTZALFFF-ZROIWOOFSA-N |
| XLogP | 3.45 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|