C14H9NO4S — CID 86222599
5-[[5-(4-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 86222599) has the molecular formula C14H9NO4S and a molecular weight of 287.30 g/mol. Its IUPAC name is 5-[[5-(4-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-(4-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86222599 |
| Molecular Formula | C14H9NO4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 5-[[5-(4-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(-c3ccc(O)cc3)o2)S1 |
| InChI | InChI=1S/C14H9NO4S/c16-9-3-1-8(2-4-9)11-6-5-10(19-11)7-12-13(17)15-14(18)20-12/h1-7,16H,(H,15,17,18) |
| InChIKey | JDXZYRMTBWZRKH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|