C16H12N2O4S — CID 87985619
N-[3-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]acetamide (PubChem CID 87985619) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is N-[3-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]acetamide.
| Compound Name | N-[3-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 87985619 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[3-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2ccc(/C=C3/SC(=O)NC3=O)o2)c1 |
| InChI | InChI=1S/C16H12N2O4S/c1-9(19)17-11-4-2-3-10(7-11)13-6-5-12(22-13)8-14-15(20)18-16(21)23-14/h2-8H,1H3,(H,17,19)(H,18,20,21)/b14-8+ |
| InChIKey | SXBULYXKIUPKIU-RIYZIHGNSA-N |
| XLogP | 3.23 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|