C17H12N2O4S — CID 87953838
[3-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]carbamic acid (PubChem CID 87953838) has the molecular formula C17H12N2O4S and a molecular weight of 340.36 g/mol. Its IUPAC name is [3-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]carbamic acid.
| Compound Name | [3-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87953838 |
| Molecular Formula | C17H12N2O4S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | [3-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(-c2ccc(/C=C3/SC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C17H12N2O4S/c20-15-14(24-17(23)19-15)8-10-4-6-11(7-5-10)12-2-1-3-13(9-12)18-16(21)22/h1-9,18H,(H,21,22)(H,19,20,23)/b14-8+ |
| InChIKey | SLFGEQRUPKCIGT-RIYZIHGNSA-N |
| XLogP | 3.77 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|