C20H18N2O4S — CID 173213389
1-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]propan-2-ylcarbamic acid (PubChem CID 173213389) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 1-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]propan-2-ylcarbamic acid.
| Compound Name | 1-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 173213389 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]propan-2-ylcarbamic acid |
| SMILES | CC(Cc1cccc(-c2ccc(C=C3SC(=O)NC3=O)cc2)c1)NC(=O)O |
| InChI | InChI=1S/C20H18N2O4S/c1-12(21-19(24)25)9-14-3-2-4-16(10-14)15-7-5-13(6-8-15)11-17-18(23)22-20(26)27-17/h2-8,10-12,21H,9H2,1H3,(H,24,25)(H,22,23,26) |
| InChIKey | NQIRNGRCUUUTRA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|