C17H14N2O4S2 — CID 173049515
2-[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]phenyl]ethylcarbamic acid (PubChem CID 173049515) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]phenyl]ethylcarbamic acid.
| Compound Name | 2-[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]phenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 173049515 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]phenyl]ethylcarbamic acid |
| SMILES | O=C(O)NCCc1cccc(-c2ccc(C=C3SC(=O)NC3=O)s2)c1 |
| InChI | InChI=1S/C17H14N2O4S2/c20-15-14(25-17(23)19-15)9-12-4-5-13(24-12)11-3-1-2-10(8-11)6-7-18-16(21)22/h1-5,8-9,18H,6-7H2,(H,21,22)(H,19,20,23) |
| InChIKey | UNADUZQOJDXDDU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|