C14H7F2NO3S2 — CID 75023402
5-[[5-(3,5-difluoro-2-hydroxyphenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 75023402) has the molecular formula C14H7F2NO3S2 and a molecular weight of 339.34 g/mol. Its IUPAC name is 5-[[5-(3,5-difluoro-2-hydroxyphenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-(3,5-difluoro-2-hydroxyphenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75023402 |
| Molecular Formula | C14H7F2NO3S2 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 5-[[5-(3,5-difluoro-2-hydroxyphenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(-c3cc(F)cc(F)c3O)s2)S1 |
| InChI | InChI=1S/C14H7F2NO3S2/c15-6-3-8(12(18)9(16)4-6)10-2-1-7(21-10)5-11-13(19)17-14(20)22-11/h1-5,18H,(H,17,19,20) |
| InChIKey | NRUOQMAAFHGBEE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|