C16H15N2O3S2+ — CID 142877896
[5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-hydroxy-methylazanium (PubChem CID 142877896) has the molecular formula C16H15N2O3S2+ and a molecular weight of 347.44 g/mol. Its IUPAC name is [5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-hydroxy-methylazanium.
| Compound Name | [5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-hydroxy-methylazanium |
|---|---|
| PubChem CID | 142877896 |
| Molecular Formula | C16H15N2O3S2+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | [5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-hydroxy-methylazanium |
| SMILES | Cc1ccc(-c2ccc(C=C3SC(=O)NC3=O)s2)cc1[NH+](C)O |
| InChI | InChI=1S/C16H14N2O3S2/c1-9-3-4-10(7-12(9)18(2)21)13-6-5-11(22-13)8-14-15(19)17-16(20)23-14/h3-8,21H,1-2H3,(H,17,19,20)/p+1 |
| InChIKey | FWFZPZSSTKLANR-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|