C26H20N2O4S — CID 175547869
N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-methyl-N-(4-methylbenzoyl)benzamide (PubChem CID 175547869) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-methyl-N-(4-methylbenzoyl)benzamide.
| Compound Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-methyl-N-(4-methylbenzoyl)benzamide |
|---|---|
| PubChem CID | 175547869 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-methyl-N-(4-methylbenzoyl)benzamide |
| SMILES | Cc1ccc(C(=O)N(C(=O)c2ccc(C)cc2)c2ccc(C=C3SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C26H20N2O4S/c1-16-3-9-19(10-4-16)24(30)28(25(31)20-11-5-17(2)6-12-20)21-13-7-18(8-14-21)15-22-23(29)27-26(32)33-22/h3-15H,1-2H3,(H,27,29,32) |
| InChIKey | GRKUVBDDGQYEBF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|