C27H23NO3S — CID 59099662
(5Z)-5-[[4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 59099662) has the molecular formula C27H23NO3S and a molecular weight of 441.55 g/mol. Its IUPAC name is (5Z)-5-[[4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59099662 |
| Molecular Formula | C27H23NO3S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (5Z)-5-[[4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C/C(=C/c1cc(C)cc(C)c1)c1ccc(Oc2ccc(/C=C3\SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C27H23NO3S/c1-17-12-18(2)14-21(13-17)15-19(3)22-6-10-24(11-7-22)31-23-8-4-20(5-9-23)16-25-26(29)28-27(30)32-25/h4-16H,1-3H3,(H,28,29,30)/b19-15-,25-16- |
| InChIKey | NDBHRVPKWRUSPD-IKABZABLSA-N |
| XLogP | 6.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|