C23H18N2O6S2 — CID 59039014
4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 59039014) has the molecular formula C23H18N2O6S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59039014 |
| Molecular Formula | C23H18N2O6S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(Oc3ccc(/C=C4/SC(=O)NC4=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H18N2O6S2/c1-30-17-8-4-16(5-9-17)25-33(28,29)20-12-10-19(11-13-20)31-18-6-2-15(3-7-18)14-21-22(26)24-23(27)32-21/h2-14,25H,1H3,(H,24,26,27)/b21-14+ |
| InChIKey | FWKCFQQCVPUFSP-KGENOOAVSA-N |
| XLogP | 4.61 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|