C22H15ClN2O5S2 — CID 59039033
N-(4-chlorophenyl)-4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]benzenesulfonamide (PubChem CID 59039033) has the molecular formula C22H15ClN2O5S2 and a molecular weight of 486.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 59039033 |
| Molecular Formula | C22H15ClN2O5S2 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | N-(4-chlorophenyl)-4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]benzenesulfonamide |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(Oc3ccc(S(=O)(=O)Nc4ccc(Cl)cc4)cc3)cc2)S1 |
| InChI | InChI=1S/C22H15ClN2O5S2/c23-15-3-5-16(6-4-15)25-32(28,29)19-11-9-18(10-12-19)30-17-7-1-14(2-8-17)13-20-21(26)24-22(27)31-20/h1-13,25H,(H,24,26,27)/b20-13+ |
| InChIKey | NAOUAWUHTODSGQ-DEDYPNTBSA-N |
| XLogP | 5.26 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|