C14H9ClN2O4S — CID 973584
4-chloro-N-(1,3-dioxoisoindol-5-yl)benzenesulfonamide (PubChem CID 973584) has the molecular formula C14H9ClN2O4S and a molecular weight of 336.76 g/mol. Its IUPAC name is 4-chloro-N-(1,3-dioxoisoindol-5-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(1,3-dioxoisoindol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 973584 |
| Molecular Formula | C14H9ClN2O4S |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 4-chloro-N-(1,3-dioxoisoindol-5-yl)benzenesulfonamide |
| SMILES | O=C1NC(=O)c2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C14H9ClN2O4S/c15-8-1-4-10(5-2-8)22(20,21)17-9-3-6-11-12(7-9)14(19)16-13(11)18/h1-7,17H,(H,16,18,19) |
| InChIKey | AXASLJDRTUFIFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|