C16H14N2O5S — CID 100820442
N-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 100820442) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 100820442 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C16H14N2O5S/c1-2-23-11-5-3-10(4-6-11)18-24(21,22)12-7-8-13-14(9-12)16(20)17-15(13)19/h3-9,18H,2H2,1H3,(H,17,19,20) |
| InChIKey | NGPKHONVICOFBK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|