C15H12N2O5S — CID 1244571
N-(1,3-dioxoisoindol-5-yl)-4-methoxybenzenesulfonamide (PubChem CID 1244571) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-4-methoxybenzenesulfonamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 1244571 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C15H12N2O5S/c1-22-10-3-5-11(6-4-10)23(20,21)17-9-2-7-12-13(8-9)15(19)16-14(12)18/h2-8,17H,1H3,(H,16,18,19) |
| InChIKey | OZXOPOQVTQQLKN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|