C18H20N2O4S2 — CID 20903343
N-(4-ethoxyphenyl)-2-ethyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 20903343) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-ethyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | N-(4-ethoxyphenyl)-2-ethyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 20903343 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-ethyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)C(CC)S3)cc1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-3-16-18(21)19-15-11-14(9-10-17(15)25-16)26(22,23)20-12-5-7-13(8-6-12)24-4-2/h5-11,16,20H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | GNCSTFHWXAOAQF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |