C15H13F4NO3S — CID 28560515
4-ethoxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 28560515) has the molecular formula C15H13F4NO3S and a molecular weight of 363.33 g/mol. Its IUPAC name is 4-ethoxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 28560515 |
| Molecular Formula | C15H13F4NO3S |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-ethoxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H13F4NO3S/c1-2-23-11-4-6-12(7-5-11)24(21,22)20-10-3-8-14(16)13(9-10)15(17,18)19/h3-9,20H,2H2,1H3 |
| InChIKey | YGKYVHJRLSQJOQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |