C20H18F2N2O5S2 — CID 2488296
N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,4-difluorobenzenesulfonamide (PubChem CID 2488296) has the molecular formula C20H18F2N2O5S2 and a molecular weight of 468.50 g/mol. Its IUPAC name is N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 2488296 |
| Molecular Formula | C20H18F2N2O5S2 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3ccc(F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C20H18F2N2O5S2/c1-2-29-17-8-4-15(5-9-17)23-30(25,26)18-10-6-16(7-11-18)24-31(27,28)20-12-3-14(21)13-19(20)22/h3-13,23-24H,2H2,1H3 |
| InChIKey | GKPBVENUGUHEHI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |