C19H15F2NO3S — CID 2494967
2,4-difluoro-N-[4-(4-methylphenoxy)phenyl]benzenesulfonamide (PubChem CID 2494967) has the molecular formula C19H15F2NO3S and a molecular weight of 375.40 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-(4-methylphenoxy)phenyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[4-(4-methylphenoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2494967 |
| Molecular Formula | C19H15F2NO3S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2,4-difluoro-N-[4-(4-methylphenoxy)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(Oc2ccc(NS(=O)(=O)c3ccc(F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C19H15F2NO3S/c1-13-2-7-16(8-3-13)25-17-9-5-15(6-10-17)22-26(23,24)19-11-4-14(20)12-18(19)21/h2-12,22H,1H3 |
| InChIKey | LGIJINWDAOIBDL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |