C16H18F2N2O2S — CID 3377300
N-[4-(diethylamino)phenyl]-2,4-difluorobenzenesulfonamide (PubChem CID 3377300) has the molecular formula C16H18F2N2O2S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3377300 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C16H18F2N2O2S/c1-3-20(4-2)14-8-6-13(7-9-14)19-23(21,22)16-10-5-12(17)11-15(16)18/h5-11,19H,3-4H2,1-2H3 |
| InChIKey | GJCVQXMMBVRJAZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|