C13H10F3NO2S — CID 5020613
2,4-difluoro-N-(4-fluoro-2-methylphenyl)benzenesulfonamide (PubChem CID 5020613) has the molecular formula C13H10F3NO2S and a molecular weight of 301.29 g/mol. Its IUPAC name is 2,4-difluoro-N-(4-fluoro-2-methylphenyl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-(4-fluoro-2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5020613 |
| Molecular Formula | C13H10F3NO2S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2,4-difluoro-N-(4-fluoro-2-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H10F3NO2S/c1-8-6-9(14)2-4-12(8)17-20(18,19)13-5-3-10(15)7-11(13)16/h2-7,17H,1H3 |
| InChIKey | ZVJDHCIIQROCIM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |