C12H7F3INO2S — CID 3263400
2,4-difluoro-N-(2-fluoro-4-iodophenyl)benzenesulfonamide (PubChem CID 3263400) has the molecular formula C12H7F3INO2S and a molecular weight of 413.16 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-fluoro-4-iodophenyl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-(2-fluoro-4-iodophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3263400 |
| Molecular Formula | C12H7F3INO2S |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 412.92 |
| IUPAC Name | 2,4-difluoro-N-(2-fluoro-4-iodophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(I)cc1F)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H7F3INO2S/c13-7-1-4-12(10(15)5-7)20(18,19)17-11-3-2-8(16)6-9(11)14/h1-6,17H |
| InChIKey | IWOXXMZDZZJBHX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|