C13H9F4NO2S — CID 24656227
4-fluoro-2-methyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 24656227) has the molecular formula C13H9F4NO2S and a molecular weight of 319.28 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24656227 |
| Molecular Formula | C13H9F4NO2S |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 4-fluoro-2-methyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H9F4NO2S/c1-7-6-8(14)2-5-11(7)21(19,20)18-10-4-3-9(15)12(16)13(10)17/h2-6,18H,1H3 |
| InChIKey | CWWRISQIBNWPFO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|