C16H15FN2O3S2 — CID 20903340
2-ethyl-N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 20903340) has the molecular formula C16H15FN2O3S2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-ethyl-N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 2-ethyl-N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 20903340 |
| Molecular Formula | C16H15FN2O3S2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-ethyl-N-(3-fluorophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | CCC1Sc2ccc(S(=O)(=O)Nc3cccc(F)c3)cc2NC1=O |
| InChI | InChI=1S/C16H15FN2O3S2/c1-2-14-16(20)18-13-9-12(6-7-15(13)23-14)24(21,22)19-11-5-3-4-10(17)8-11/h3-9,14,19H,2H2,1H3,(H,18,20) |
| InChIKey | YZOHKKMANRTWBU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |