C13H12N4O3S2 — CID 110759504
2-methyl-3-oxo-N-pyrimidin-2-yl-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 110759504) has the molecular formula C13H12N4O3S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-pyrimidin-2-yl-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 2-methyl-3-oxo-N-pyrimidin-2-yl-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 110759504 |
| Molecular Formula | C13H12N4O3S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-methyl-3-oxo-N-pyrimidin-2-yl-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | CC1Sc2ccc(S(=O)(=O)Nc3ncccn3)cc2NC1=O |
| InChI | InChI=1S/C13H12N4O3S2/c1-8-12(18)16-10-7-9(3-4-11(10)21-8)22(19,20)17-13-14-5-2-6-15-13/h2-8H,1H3,(H,16,18)(H,14,15,17) |
| InChIKey | ATINGOZFKPAGKQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |